C17H24N2O4 — CID 108547664
1-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]pentan-1-one (PubChem CID 108547664) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]pentan-1-one.
| Compound Name | 1-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 108547664 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[4-(3,5-dihydroxybenzoyl)-1,4-diazepan-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C17H24N2O4/c1-2-3-5-16(22)18-6-4-7-19(9-8-18)17(23)13-10-14(20)12-15(21)11-13/h10-12,20-21H,2-9H2,1H3 |
| InChIKey | VUSOPXVCKXJJSZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |