C17H30O5Si — CID 10854812
[(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10854812) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is [(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10854812 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(2R,3S,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-prop-2-enoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=CCO[C@@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C17H30O5Si/c1-8-11-19-16-10-9-14(15(21-16)12-20-13(2)18)22-23(6,7)17(3,4)5/h8-10,14-16H,1,11-12H2,2-7H3/t14-,15+,16-/m0/s1 |
| InChIKey | VDKMJCQQGIORGS-XHSDSOJGSA-N |
| XLogP | 3.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|