C9H15NO — CID 10855671
(E,2S)-2-hydroxynon-3-enenitrile (PubChem CID 10855671) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (E,2S)-2-hydroxynon-3-enenitrile.
| Compound Name | (E,2S)-2-hydroxynon-3-enenitrile |
|---|---|
| PubChem CID | 10855671 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (E,2S)-2-hydroxynon-3-enenitrile |
| SMILES | CCCCC/C=C/[C@H](O)C#N |
| InChI | InChI=1S/C9H15NO/c1-2-3-4-5-6-7-9(11)8-10/h6-7,9,11H,2-5H2,1H3/b7-6+/t9-/m0/s1 |
| InChIKey | IIJYTNPUHBMVGA-UCUJLANTSA-N |
| XLogP | 2.01 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|