C8H13NO — CID 92975566
(E,4S)-4-hydroxyoct-2-enenitrile (PubChem CID 92975566) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (E,4S)-4-hydroxyoct-2-enenitrile.
| Compound Name | (E,4S)-4-hydroxyoct-2-enenitrile |
|---|---|
| PubChem CID | 92975566 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (E,4S)-4-hydroxyoct-2-enenitrile |
| SMILES | CCCC[C@H](O)/C=C/C#N |
| InChI | InChI=1S/C8H13NO/c1-2-3-5-8(10)6-4-7-9/h4,6,8,10H,2-3,5H2,1H3/b6-4+/t8-/m0/s1 |
| InChIKey | WSRYLWOAPRCPFD-JQTRYQTASA-N |
| XLogP | 1.62 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|