C17H18F3N3O4S — CID 108562392
N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-2,3,4-trifluorobenzamide (PubChem CID 108562392) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 108562392 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-4-yl]-2,3,4-trifluorobenzamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC(NC(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H18F3N3O4S/c1-9-16(10(2)27-22-9)28(25,26)23-7-5-11(6-8-23)21-17(24)12-3-4-13(18)15(20)14(12)19/h3-4,11H,5-8H2,1-2H3,(H,21,24) |
| InChIKey | PRDPZLNJKIAWLX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|