C16H16F3N3O4S — CID 108569871
[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 108569871) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 108569871 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(C(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-9-15(10(2)26-20-9)27(24,25)22-7-5-21(6-8-22)16(23)11-3-4-12(17)14(19)13(11)18/h3-4H,5-8H2,1-2H3 |
| InChIKey | QKSGOUANFMEBAZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|