C15H16F3N3O3S — CID 113081207
3,5-dimethyl-4-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]sulfonyl-1,2-oxazole (PubChem CID 113081207) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is 3,5-dimethyl-4-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]sulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 113081207 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3,5-dimethyl-4-[4-(2,3,4-trifluorophenyl)piperazin-1-yl]sulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCN(c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H16F3N3O3S/c1-9-15(10(2)24-19-9)25(22,23)21-7-5-20(6-8-21)12-4-3-11(16)13(17)14(12)18/h3-4H,5-8H2,1-2H3 |
| InChIKey | FLNDJWQIIVPQQF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|