C10H22O3 — CID 10856286
(2S,3R)-3-(2-methoxypropan-2-yloxy)hexan-2-ol (PubChem CID 10856286) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is (2S,3R)-3-(2-methoxypropan-2-yloxy)hexan-2-ol.
| Compound Name | (2S,3R)-3-(2-methoxypropan-2-yloxy)hexan-2-ol |
|---|---|
| PubChem CID | 10856286 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (2S,3R)-3-(2-methoxypropan-2-yloxy)hexan-2-ol |
| SMILES | CCC[C@@H](OC(C)(C)OC)[C@H](C)O |
| InChI | InChI=1S/C10H22O3/c1-6-7-9(8(2)11)13-10(3,4)12-5/h8-9,11H,6-7H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | QMCQBNFLAMTKOX-DTWKUNHWSA-N |
| XLogP | 1.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|