C15H32O4 — CID 141041789
1,1,1,2-tetramethoxy-2,3,3,4-tetramethylheptane (PubChem CID 141041789) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,1,1,2-tetramethoxy-2,3,3,4-tetramethylheptane.
| Compound Name | 1,1,1,2-tetramethoxy-2,3,3,4-tetramethylheptane |
|---|---|
| PubChem CID | 141041789 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1,1,1,2-tetramethoxy-2,3,3,4-tetramethylheptane |
| SMILES | CCCC(C)C(C)(C)C(C)(OC)C(OC)(OC)OC |
| InChI | InChI=1S/C15H32O4/c1-10-11-12(2)13(3,4)14(5,16-6)15(17-7,18-8)19-9/h12H,10-11H2,1-9H3 |
| InChIKey | KIHWDDBAWFJUAA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|