C14H29Cl — CID 175373008
2-chloro-2,3-dimethylhexane;cyclohexane (PubChem CID 175373008) has the molecular formula C14H29Cl and a molecular weight of 232.84 g/mol. Its IUPAC name is 2-chloro-2,3-dimethylhexane;cyclohexane.
| Compound Name | 2-chloro-2,3-dimethylhexane;cyclohexane |
|---|---|
| PubChem CID | 175373008 |
| Molecular Formula | C14H29Cl |
| Molecular Weight | 232.84 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 2-chloro-2,3-dimethylhexane;cyclohexane |
| SMILES | C1CCCCC1.CCCC(C)C(C)(C)Cl |
| InChI | InChI=1S/C8H17Cl.C6H12/c1-5-6-7(2)8(3,4)9;1-2-4-6-5-3-1/h7H,5-6H2,1-4H3;1-6H2 |
| InChIKey | XXFGFUXVLPNYEE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.84 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|