2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate

C8H20BF4P — CID 87195673

IUPAC2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate
SMILESCCCC(C)C(C)(C)[PH3+].F[B-](F)(F)F
InChIInChI=1S/C8H19P.BF4/c1-5-6-7(2)8(3,4)9;2-1(3,4)5/h7H,5-6,9H2,1-4H3;/q;-1/p+1
InChIKeyFQTSQKUJNNXOCB-UHFFFAOYSA-O
MW234.03 g/mol
LogP4.11
Rot. Bonds3

About 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate

2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate (PubChem CID 87195673) has the molecular formula C8H20BF4P and a molecular weight of 234.03 g/mol. Its IUPAC name is 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate.

Molecular Properties

Compound Name2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate
PubChem CID87195673
Molecular FormulaC8H20BF4P
Molecular Weight234.03 g/mol
Exact Mass234.13
IUPAC Name2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate
SMILESCCCC(C)C(C)(C)[PH3+].F[B-](F)(F)F
InChIInChI=1S/C8H19P.BF4/c1-5-6-7(2)8(3,4)9;2-1(3,4)5/h7H,5-6,9H2,1-4H3;/q;-1/p+1
InChIKeyFQTSQKUJNNXOCB-UHFFFAOYSA-O
XLogP4.11
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.03
LogP ≤ 54.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate?
The IUPAC name of 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate (CID 87195673) is 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate.
What is the SMILES notation for 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate?
The canonical SMILES for 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate is CCCC(C)C(C)(C)[PH3+].F[B-](F)(F)F.
What is the InChIKey of 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate?
The InChIKey is FQTSQKUJNNXOCB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H19P.BF4/c1-5-6-7(2)8(3,4)9;2-1(3,4)5/h7H,5-6,9H2,1-4H3;/q;-1/p+1.
What are the key properties of 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate?
2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate has a molecular weight of 234.03 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate is sourced from PubChem (CID 87195673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).