C8H20BF4P — CID 87195673
2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate (PubChem CID 87195673) has the molecular formula C8H20BF4P and a molecular weight of 234.03 g/mol. Its IUPAC name is 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate.
| Compound Name | 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 87195673 |
| Molecular Formula | C8H20BF4P |
| Molecular Weight | 234.03 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2,3-dimethylhexan-2-ylphosphanium tetrafluoroborate |
| SMILES | CCCC(C)C(C)(C)[PH3+].F[B-](F)(F)F |
| InChI | InChI=1S/C8H19P.BF4/c1-5-6-7(2)8(3,4)9;2-1(3,4)5/h7H,5-6,9H2,1-4H3;/q;-1/p+1 |
| InChIKey | FQTSQKUJNNXOCB-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|