C8H17Cl3Si — CID 170850505
trichloro(2,3-dimethylhexan-2-yl)silane (PubChem CID 170850505) has the molecular formula C8H17Cl3Si and a molecular weight of 247.67 g/mol. Its IUPAC name is trichloro(2,3-dimethylhexan-2-yl)silane.
| Compound Name | trichloro(2,3-dimethylhexan-2-yl)silane |
|---|---|
| PubChem CID | 170850505 |
| Molecular Formula | C8H17Cl3Si |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | trichloro(2,3-dimethylhexan-2-yl)silane |
| SMILES | CCCC(C)C(C)(C)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H17Cl3Si/c1-5-6-7(2)8(3,4)12(9,10)11/h7H,5-6H2,1-4H3 |
| InChIKey | RVLKHUDAUUEDRB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|