C14H32N+ — CID 123269086
ethyl-dimethyl-(3,3,4-trimethylheptan-2-yl)azanium (PubChem CID 123269086) has the molecular formula C14H32N+ and a molecular weight of 214.42 g/mol. Its IUPAC name is ethyl-dimethyl-(3,3,4-trimethylheptan-2-yl)azanium.
| Compound Name | ethyl-dimethyl-(3,3,4-trimethylheptan-2-yl)azanium |
|---|---|
| PubChem CID | 123269086 |
| Molecular Formula | C14H32N+ |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.25 |
| IUPAC Name | ethyl-dimethyl-(3,3,4-trimethylheptan-2-yl)azanium |
| SMILES | CCCC(C)C(C)(C)C(C)[N+](C)(C)CC |
| InChI | InChI=1S/C14H32N/c1-9-11-12(3)14(5,6)13(4)15(7,8)10-2/h12-13H,9-11H2,1-8H3/q+1 |
| InChIKey | NXGSDYICIJZSJA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|