C15H31Cl3Si — CID 151071363
trichloro(2,3,3,4,4,5-hexamethylnonan-2-yl)silane (PubChem CID 151071363) has the molecular formula C15H31Cl3Si and a molecular weight of 345.86 g/mol. Its IUPAC name is trichloro(2,3,3,4,4,5-hexamethylnonan-2-yl)silane.
| Compound Name | trichloro(2,3,3,4,4,5-hexamethylnonan-2-yl)silane |
|---|---|
| PubChem CID | 151071363 |
| Molecular Formula | C15H31Cl3Si |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | trichloro(2,3,3,4,4,5-hexamethylnonan-2-yl)silane |
| SMILES | CCCCC(C)C(C)(C)C(C)(C)C(C)(C)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C15H31Cl3Si/c1-9-10-11-12(2)13(3,4)14(5,6)15(7,8)19(16,17)18/h12H,9-11H2,1-8H3 |
| InChIKey | MIEWZRYGWYMIIM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|