C31H60O — CID 144649244
2,2,4,4,5,5,6,7,8,8,9,9,10,10,11-pentadecamethylhexadec-6-en-3-one (PubChem CID 144649244) has the molecular formula C31H60O and a molecular weight of 448.82 g/mol. Its IUPAC name is 2,2,4,4,5,5,6,7,8,8,9,9,10,10,11-pentadecamethylhexadec-6-en-3-one.
| Compound Name | 2,2,4,4,5,5,6,7,8,8,9,9,10,10,11-pentadecamethylhexadec-6-en-3-one |
|---|---|
| PubChem CID | 144649244 |
| Molecular Formula | C31H60O |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.46 |
| IUPAC Name | 2,2,4,4,5,5,6,7,8,8,9,9,10,10,11-pentadecamethylhexadec-6-en-3-one |
| SMILES | CCCCCC(C)C(C)(C)C(C)(C)C(C)(C)C(C)=C(C)C(C)(C)C(C)(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C31H60O/c1-18-19-20-21-22(2)27(8,9)31(16,17)29(12,13)24(4)23(3)28(10,11)30(14,15)25(32)26(5,6)7/h22H,18-21H2,1-17H3 |
| InChIKey | KWVYBRHILOQFGK-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|