C16H25N3O4 — CID 108568620
prop-2-enyl 4-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperazine-1-carboxylate (PubChem CID 108568620) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is prop-2-enyl 4-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108568620 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | prop-2-enyl 4-(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(C(=O)C2CC(=O)N(C(C)C)C2)CC1 |
| InChI | InChI=1S/C16H25N3O4/c1-4-9-23-16(22)18-7-5-17(6-8-18)15(21)13-10-14(20)19(11-13)12(2)3/h4,12-13H,1,5-11H2,2-3H3 |
| InChIKey | VVMRIWVPVAQIPO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|