C12H17NO3 — CID 10857078
5-amino-2,4-dimethoxy-3-methyl-6-prop-2-enylphenol (PubChem CID 10857078) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 5-amino-2,4-dimethoxy-3-methyl-6-prop-2-enylphenol.
| Compound Name | 5-amino-2,4-dimethoxy-3-methyl-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 10857078 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 5-amino-2,4-dimethoxy-3-methyl-6-prop-2-enylphenol |
| SMILES | C=CCc1c(N)c(OC)c(C)c(OC)c1O |
| InChI | InChI=1S/C12H17NO3/c1-5-6-8-9(13)11(15-3)7(2)12(16-4)10(8)14/h5,14H,1,6,13H2,2-4H3 |
| InChIKey | DTKJLIYQOPMKPH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|