C8H8F3NO3 — CID 177201966
3-amino-2-methoxy-5-(trifluoromethyl)benzene-1,4-diol (PubChem CID 177201966) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 3-amino-2-methoxy-5-(trifluoromethyl)benzene-1,4-diol.
| Compound Name | 3-amino-2-methoxy-5-(trifluoromethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 177201966 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-amino-2-methoxy-5-(trifluoromethyl)benzene-1,4-diol |
| SMILES | COc1c(O)cc(C(F)(F)F)c(O)c1N |
| InChI | InChI=1S/C8H8F3NO3/c1-15-7-4(13)2-3(8(9,10)11)6(14)5(7)12/h2,13-14H,12H2,1H3 |
| InChIKey | OGCUIQBITSJTGO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|