C22H28F3NO3 — CID 177201956
2-amino-6-methyl-3-(trifluoromethoxy)-5-(2,4,4-trimethyl-5-phenylpentan-2-yl)benzene-1,4-diol (PubChem CID 177201956) has the molecular formula C22H28F3NO3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-amino-6-methyl-3-(trifluoromethoxy)-5-(2,4,4-trimethyl-5-phenylpentan-2-yl)benzene-1,4-diol.
| Compound Name | 2-amino-6-methyl-3-(trifluoromethoxy)-5-(2,4,4-trimethyl-5-phenylpentan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 177201956 |
| Molecular Formula | C22H28F3NO3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-amino-6-methyl-3-(trifluoromethoxy)-5-(2,4,4-trimethyl-5-phenylpentan-2-yl)benzene-1,4-diol |
| SMILES | Cc1c(O)c(N)c(OC(F)(F)F)c(O)c1C(C)(C)CC(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H28F3NO3/c1-13-15(18(28)19(16(26)17(13)27)29-22(23,24)25)21(4,5)12-20(2,3)11-14-9-7-6-8-10-14/h6-10,27-28H,11-12,26H2,1-5H3 |
| InChIKey | GLQLDJHYOWTLPR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|