C14H20F3NO3S — CID 177201962
2-amino-5-(1-ethylsulfanyl-2-methylpropan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol (PubChem CID 177201962) has the molecular formula C14H20F3NO3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-amino-5-(1-ethylsulfanyl-2-methylpropan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol.
| Compound Name | 2-amino-5-(1-ethylsulfanyl-2-methylpropan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol |
|---|---|
| PubChem CID | 177201962 |
| Molecular Formula | C14H20F3NO3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-amino-5-(1-ethylsulfanyl-2-methylpropan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol |
| SMILES | CCSCC(C)(C)c1c(C)c(O)c(N)c(OC(F)(F)F)c1O |
| InChI | InChI=1S/C14H20F3NO3S/c1-5-22-6-13(3,4)8-7(2)10(19)9(18)12(11(8)20)21-14(15,16)17/h19-20H,5-6,18H2,1-4H3 |
| InChIKey | HSSLRPUSTZLIAP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|