C16H24F3NO3 — CID 177201965
2-amino-3-methoxy-6-(trifluoromethyl)-5-(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol (PubChem CID 177201965) has the molecular formula C16H24F3NO3 and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-amino-3-methoxy-6-(trifluoromethyl)-5-(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol.
| Compound Name | 2-amino-3-methoxy-6-(trifluoromethyl)-5-(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 177201965 |
| Molecular Formula | C16H24F3NO3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-amino-3-methoxy-6-(trifluoromethyl)-5-(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol |
| SMILES | COc1c(N)c(O)c(C(F)(F)F)c(C(C)(C)CC(C)(C)C)c1O |
| InChI | InChI=1S/C16H24F3NO3/c1-14(2,3)7-15(4,5)8-9(16(17,18)19)11(21)10(20)13(23-6)12(8)22/h21-22H,7,20H2,1-6H3 |
| InChIKey | KZSZTJZFWVMBBE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|