C16H24F3NO4 — CID 177201963
2-amino-5-(5-hydroxy-2,4,4-trimethylpentan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol (PubChem CID 177201963) has the molecular formula C16H24F3NO4 and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-amino-5-(5-hydroxy-2,4,4-trimethylpentan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol.
| Compound Name | 2-amino-5-(5-hydroxy-2,4,4-trimethylpentan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol |
|---|---|
| PubChem CID | 177201963 |
| Molecular Formula | C16H24F3NO4 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-amino-5-(5-hydroxy-2,4,4-trimethylpentan-2-yl)-6-methyl-3-(trifluoromethoxy)benzene-1,4-diol |
| SMILES | Cc1c(O)c(N)c(OC(F)(F)F)c(O)c1C(C)(C)CC(C)(C)CO |
| InChI | InChI=1S/C16H24F3NO4/c1-8-9(15(4,5)6-14(2,3)7-21)12(23)13(10(20)11(8)22)24-16(17,18)19/h21-23H,6-7,20H2,1-5H3 |
| InChIKey | IFNKARXGCIJFME-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|