C13H10F3NO6 — CID 176658682
6-(4-amino-2,3,6-trifluoro-5-methoxyphenyl)benzene-1,2,3,4,5-pentol (PubChem CID 176658682) has the molecular formula C13H10F3NO6 and a molecular weight of 333.22 g/mol. Its IUPAC name is 6-(4-amino-2,3,6-trifluoro-5-methoxyphenyl)benzene-1,2,3,4,5-pentol.
| Compound Name | 6-(4-amino-2,3,6-trifluoro-5-methoxyphenyl)benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 176658682 |
| Molecular Formula | C13H10F3NO6 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 6-(4-amino-2,3,6-trifluoro-5-methoxyphenyl)benzene-1,2,3,4,5-pentol |
| SMILES | COc1c(N)c(F)c(F)c(-c2c(O)c(O)c(O)c(O)c2O)c1F |
| InChI | InChI=1S/C13H10F3NO6/c1-23-13-5(15)2(4(14)6(16)7(13)17)3-8(18)10(20)12(22)11(21)9(3)19/h18-22H,17H2,1H3 |
| InChIKey | DTSQBRZBQUMHKN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|