C13H6F7NO4 — CID 165401837
2-(4-amino-2,3,5,6-tetrafluorophenyl)-4-(trifluoromethoxy)benzene-1,3,5-triol (PubChem CID 165401837) has the molecular formula C13H6F7NO4 and a molecular weight of 373.18 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetrafluorophenyl)-4-(trifluoromethoxy)benzene-1,3,5-triol.
| Compound Name | 2-(4-amino-2,3,5,6-tetrafluorophenyl)-4-(trifluoromethoxy)benzene-1,3,5-triol |
|---|---|
| PubChem CID | 165401837 |
| Molecular Formula | C13H6F7NO4 |
| Molecular Weight | 373.18 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetrafluorophenyl)-4-(trifluoromethoxy)benzene-1,3,5-triol |
| SMILES | Nc1c(F)c(F)c(-c2c(O)cc(O)c(OC(F)(F)F)c2O)c(F)c1F |
| InChI | InChI=1S/C13H6F7NO4/c14-6-5(7(15)9(17)10(21)8(6)16)4-2(22)1-3(23)12(11(4)24)25-13(18,19)20/h1,22-24H,21H2 |
| InChIKey | PVOZNBPEXPTSHZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|