C13H9F4NO5 — CID 165401854
4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol (PubChem CID 165401854) has the molecular formula C13H9F4NO5 and a molecular weight of 335.21 g/mol. Its IUPAC name is 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol.
| Compound Name | 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 165401854 |
| Molecular Formula | C13H9F4NO5 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-(4-amino-3-fluorophenyl)-6-(trifluoromethoxy)benzene-1,2,3,5-tetrol |
| SMILES | Nc1ccc(-c2c(O)c(O)c(O)c(OC(F)(F)F)c2O)cc1F |
| InChI | InChI=1S/C13H9F4NO5/c14-5-3-4(1-2-6(5)18)7-8(19)10(21)11(22)12(9(7)20)23-13(15,16)17/h1-3,19-22H,18H2 |
| InChIKey | RKGCOEXKHQEXJU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|