C19H24N4O4S — CID 108574896
N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-(dimethylamino)benzamide (PubChem CID 108574896) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 108574896 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[2-[(4-acetamidophenyl)sulfonylamino]ethyl]-4-(dimethylamino)benzamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCNC(=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-14(24)22-16-6-10-18(11-7-16)28(26,27)21-13-12-20-19(25)15-4-8-17(9-5-15)23(2)3/h4-11,21H,12-13H2,1-3H3,(H,20,25)(H,22,24) |
| InChIKey | BHGOMPRGZUCPKM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|