C25H24ClNO7 — CID 108580535
3-(5-chloro-1-benzofuran-2-carbonyl)-2-(2,3-dimethoxyphenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one (PubChem CID 108580535) has the molecular formula C25H24ClNO7 and a molecular weight of 485.92 g/mol. Its IUPAC name is 3-(5-chloro-1-benzofuran-2-carbonyl)-2-(2,3-dimethoxyphenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-1-benzofuran-2-carbonyl)-2-(2,3-dimethoxyphenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108580535 |
| Molecular Formula | C25H24ClNO7 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-(5-chloro-1-benzofuran-2-carbonyl)-2-(2,3-dimethoxyphenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)ccc3o2)C1c1cccc(OC)c1OC |
| InChI | InChI=1S/C25H24ClNO7/c1-31-11-5-10-27-21(16-6-4-7-18(32-2)24(16)33-3)20(23(29)25(27)30)22(28)19-13-14-12-15(26)8-9-17(14)34-19/h4,6-9,12-13,21,29H,5,10-11H2,1-3H3 |
| InChIKey | CPMYULFRTCJCRH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|