C23H19BrFNO5 — CID 108645657
3-(5-bromo-1-benzofuran-2-carbonyl)-2-(2-fluorophenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one (PubChem CID 108645657) has the molecular formula C23H19BrFNO5 and a molecular weight of 488.31 g/mol. Its IUPAC name is 3-(5-bromo-1-benzofuran-2-carbonyl)-2-(2-fluorophenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one.
| Compound Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-(2-fluorophenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108645657 |
| Molecular Formula | C23H19BrFNO5 |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-2-(2-fluorophenyl)-4-hydroxy-1-(3-methoxypropyl)-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Br)ccc3o2)C1c1ccccc1F |
| InChI | InChI=1S/C23H19BrFNO5/c1-30-10-4-9-26-20(15-5-2-3-6-16(15)25)19(22(28)23(26)29)21(27)18-12-13-11-14(24)7-8-17(13)31-18/h2-3,5-8,11-12,20,28H,4,9-10H2,1H3 |
| InChIKey | LEMVIGXMRMZUTD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|