C25H22BrNO7 — CID 108611276
[3-[3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108611276) has the molecular formula C25H22BrNO7 and a molecular weight of 528.36 g/mol. Its IUPAC name is [3-[3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [3-[3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108611276 |
| Molecular Formula | C25H22BrNO7 |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | [3-[3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Br)ccc3o2)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C25H22BrNO7/c1-14(28)33-18-6-3-5-15(12-18)22-21(24(30)25(31)27(22)9-4-10-32-2)23(29)20-13-16-11-17(26)7-8-19(16)34-20/h3,5-8,11-13,22,30H,4,9-10H2,1-2H3 |
| InChIKey | XSLOYMXARIPTED-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|