C26H26BrNO6 — CID 108611967
3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one (PubChem CID 108611967) has the molecular formula C26H26BrNO6 and a molecular weight of 528.40 g/mol. Its IUPAC name is 3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108611967 |
| Molecular Formula | C26H26BrNO6 |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 3-(5-bromo-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1cccc(C2C(C(=O)c3cc4cc(Br)ccc4o3)=C(O)C(=O)N2CCCOC)c1 |
| InChI | InChI=1S/C26H26BrNO6/c1-3-11-33-19-7-4-6-16(14-19)23-22(25(30)26(31)28(23)10-5-12-32-2)24(29)21-15-17-13-18(27)8-9-20(17)34-21/h4,6-9,13-15,23,30H,3,5,10-12H2,1-2H3 |
| InChIKey | YINUGSVBGFFUNO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|