C24H15N3O5S — CID 108590510
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108590510) has the molecular formula C24H15N3O5S and a molecular weight of 457.47 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108590510 |
| Molecular Formula | C24H15N3O5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(1,3-benzothiazol-2-yl)-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccccc3s2)C(c2ccccn2)/C1=C(\O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H15N3O5S/c28-21(13-8-9-16-17(11-13)32-12-31-16)19-20(15-6-3-4-10-25-15)27(23(30)22(19)29)24-26-14-5-1-2-7-18(14)33-24/h1-11,20,28H,12H2/b21-19+ |
| InChIKey | GQSNNDBHCOXSFV-XUTLUUPISA-N |
| XLogP | 4.05 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|