C24H14N4O7S — CID 108724944
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108724944) has the molecular formula C24H14N4O7S and a molecular weight of 502.46 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108724944 |
| Molecular Formula | C24H14N4O7S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(6-nitro-1,3-benzothiazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)C(c2cccnc2)/C1=C(\O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H14N4O7S/c29-21(12-3-6-16-17(8-12)35-11-34-16)19-20(13-2-1-7-25-10-13)27(23(31)22(19)30)24-26-15-5-4-14(28(32)33)9-18(15)36-24/h1-10,20,29H,11H2/b21-19+ |
| InChIKey | NZJUVCKPAGFWGE-XUTLUUPISA-N |
| XLogP | 3.95 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|