C13H17BrO4 — CID 10860073
(1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxy-6-methylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10860073) has the molecular formula C13H17BrO4 and a molecular weight of 317.18 g/mol. Its IUPAC name is (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxy-6-methylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxy-6-methylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10860073 |
| Molecular Formula | C13H17BrO4 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (1R,4R,7S)-7-acetyl-5-bromo-3,3-dimethoxy-6-methylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C(C)=C(Br)[C@@H]1C[C@@H]2C(C)=O |
| InChI | InChI=1S/C13H17BrO4/c1-6-10-8(7(2)15)5-9(11(6)14)13(17-3,18-4)12(10)16/h8-10H,5H2,1-4H3/t8-,9+,10+/m1/s1 |
| InChIKey | BNTXHMIBXYLHRY-UTLUCORTSA-N |
| XLogP | 2.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|