C18H29NO4 — CID 10860289
tert-butyl 2-(2-ethoxycarbonylcyclohexen-1-yl)pyrrolidine-1-carboxylate (PubChem CID 10860289) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl 2-(2-ethoxycarbonylcyclohexen-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-ethoxycarbonylcyclohexen-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10860289 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl 2-(2-ethoxycarbonylcyclohexen-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C1=C(C2CCCN2C(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C18H29NO4/c1-5-22-16(20)14-10-7-6-9-13(14)15-11-8-12-19(15)17(21)23-18(2,3)4/h15H,5-12H2,1-4H3 |
| InChIKey | DBUOETHAOIZBSR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |