C17H32O2Si2 — CID 10860337
[4,4-bis(methoxymethyl)-7-trimethylsilylhepta-1,6-diynyl]-trimethylsilane (PubChem CID 10860337) has the molecular formula C17H32O2Si2 and a molecular weight of 324.61 g/mol. Its IUPAC name is [4,4-bis(methoxymethyl)-7-trimethylsilylhepta-1,6-diynyl]-trimethylsilane.
| Compound Name | [4,4-bis(methoxymethyl)-7-trimethylsilylhepta-1,6-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10860337 |
| Molecular Formula | C17H32O2Si2 |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [4,4-bis(methoxymethyl)-7-trimethylsilylhepta-1,6-diynyl]-trimethylsilane |
| SMILES | COCC(CC#C[Si](C)(C)C)(CC#C[Si](C)(C)C)COC |
| InChI | InChI=1S/C17H32O2Si2/c1-18-15-17(16-19-2,11-9-13-20(3,4)5)12-10-14-21(6,7)8/h11-12,15-16H2,1-8H3 |
| InChIKey | RVJXKBHDQAKXRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|