C42H78O4Si4 — CID 177460209
triethyl-[2-prop-2-ynyl-2,9,9-tris(triethylsilyloxymethyl)dodeca-4,6,11-triynoxy]silane (PubChem CID 177460209) has the molecular formula C42H78O4Si4 and a molecular weight of 759.43 g/mol. Its IUPAC name is triethyl-[2-prop-2-ynyl-2,9,9-tris(triethylsilyloxymethyl)dodeca-4,6,11-triynoxy]silane.
| Compound Name | triethyl-[2-prop-2-ynyl-2,9,9-tris(triethylsilyloxymethyl)dodeca-4,6,11-triynoxy]silane |
|---|---|
| PubChem CID | 177460209 |
| Molecular Formula | C42H78O4Si4 |
| Molecular Weight | 759.43 g/mol |
| Exact Mass | 758.50 |
| IUPAC Name | triethyl-[2-prop-2-ynyl-2,9,9-tris(triethylsilyloxymethyl)dodeca-4,6,11-triynoxy]silane |
| SMILES | C#CCC(CC#CC#CCC(CC#C)(CO[Si](CC)(CC)CC)CO[Si](CC)(CC)CC)(CO[Si](CC)(CC)CC)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C42H78O4Si4/c1-15-33-41(37-43-47(17-3,18-4)19-5,38-44-48(20-6,21-7)22-8)35-31-29-30-32-36-42(34-16-2,39-45-49(23-9,24-10)25-11)40-46-50(26-12,27-13)28-14/h1-2H,17-28,33-40H2,3-14H3 |
| InChIKey | VVUBMLYSRSCORE-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.43 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|