C25H25ClN2O6 — CID 108628231
3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-propan-2-yloxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one (PubChem CID 108628231) has the molecular formula C25H25ClN2O6 and a molecular weight of 484.94 g/mol. Its IUPAC name is 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-propan-2-yloxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-propan-2-yloxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108628231 |
| Molecular Formula | C25H25ClN2O6 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-propan-2-yloxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
| SMILES | COc1cc(Cl)cc2cc(C(=O)C3=C(O)C(=O)N(CCCOC(C)C)C3c3ccccn3)oc12 |
| InChI | InChI=1S/C25H25ClN2O6/c1-14(2)33-10-6-9-28-21(17-7-4-5-8-27-17)20(23(30)25(28)31)22(29)18-12-15-11-16(26)13-19(32-3)24(15)34-18/h4-5,7-8,11-14,21,30H,6,9-10H2,1-3H3 |
| InChIKey | JGOVRKLXOJOGOB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|