C23H21ClN2O6 — CID 108627686
3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one (PubChem CID 108627686) has the molecular formula C23H21ClN2O6 and a molecular weight of 456.88 g/mol. Its IUPAC name is 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108627686 |
| Molecular Formula | C23H21ClN2O6 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-4-hydroxy-1-(3-methoxypropyl)-2-pyridin-2-yl-2H-pyrrol-5-one |
| SMILES | COCCCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1ccccn1 |
| InChI | InChI=1S/C23H21ClN2O6/c1-30-9-5-8-26-19(15-6-3-4-7-25-15)18(21(28)23(26)29)20(27)16-11-13-10-14(24)12-17(31-2)22(13)32-16/h3-4,6-7,10-12,19,28H,5,8-9H2,1-2H3 |
| InChIKey | TUZMYBGMZYJOBL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|