C27H39NO5Si — CID 10863851
benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate (PubChem CID 10863851) has the molecular formula C27H39NO5Si and a molecular weight of 485.70 g/mol. Its IUPAC name is benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate.
| Compound Name | benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 10863851 |
| Molecular Formula | C27H39NO5Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | benzyl (1S,5S,8aS,8bR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylate |
| SMILES | CO[C@H]1CCC[C@H]2C1=C(C(=O)OCc1ccccc1)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C27H39NO5Si/c1-17(33-34(6,7)27(2,3)4)21-23-19-14-11-15-20(31-5)22(19)24(28(23)25(21)29)26(30)32-16-18-12-9-8-10-13-18/h8-10,12-13,17,19-21,23H,11,14-16H2,1-7H3/t17-,19+,20+,21-,23-/m1/s1 |
| InChIKey | DKPOHLKXVWAGEA-XSEKTIEYSA-N |
| XLogP | 5.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|