C29H42O6Si — CID 10864187
[(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-10-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate (PubChem CID 10864187) has the molecular formula C29H42O6Si and a molecular weight of 514.74 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-10-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate.
| Compound Name | [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-10-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate |
|---|---|
| PubChem CID | 10864187 |
| Molecular Formula | C29H42O6Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-methylidene-10-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodecan-4-yl] acetate |
| SMILES | C=C1C(=O)C[C@]2(CO[Si](C)(C)C(C)(C)C)C[C@H]3[C@@H](OCc4ccccc4)[C@@H](OC(C)=O)C[C@@H](C)[C@]13O2 |
| InChI | InChI=1S/C29H42O6Si/c1-19-14-25(34-21(3)30)26(32-17-22-12-10-9-11-13-22)23-15-28(18-33-36(7,8)27(4,5)6)16-24(31)20(2)29(19,23)35-28/h9-13,19,23,25-26H,2,14-18H2,1,3-8H3/t19-,23+,25+,26-,28+,29+/m1/s1 |
| InChIKey | CWMKCDSOWIMDCG-VCUBORTBSA-N |
| XLogP | 5.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|