C28H40O6Si — CID 10896376
[(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodec-9-en-4-yl] acetate (PubChem CID 10896376) has the molecular formula C28H40O6Si and a molecular weight of 500.71 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodec-9-en-4-yl] acetate.
| Compound Name | [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodec-9-en-4-yl] acetate |
|---|---|
| PubChem CID | 10896376 |
| Molecular Formula | C28H40O6Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [(1R,2R,4S,5R,6S,8S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyl-11-oxo-5-phenylmethoxy-12-oxatricyclo[6.3.1.01,6]dodec-9-en-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C)[C@]23O[C@](CO[Si](C)(C)C(C)(C)C)(C=CC2=O)C[C@H]3[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H40O6Si/c1-19-15-23(33-20(2)29)25(31-17-21-11-9-8-10-12-21)22-16-27(14-13-24(30)28(19,22)34-27)18-32-35(6,7)26(3,4)5/h8-14,19,22-23,25H,15-18H2,1-7H3/t19-,22+,23+,25-,27-,28-/m1/s1 |
| InChIKey | SNDUENJUUJWEEH-GIGNSAJXSA-N |
| XLogP | 5.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|