C28H38O7Si — CID 10006696
methyl (1S,4R,5R,8R,9S,11R,13R,14R)-5-[tert-butyl(dimethyl)silyl]oxy-8-(2-oxoethyl)-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate (PubChem CID 10006696) has the molecular formula C28H38O7Si and a molecular weight of 514.69 g/mol. Its IUPAC name is methyl (1S,4R,5R,8R,9S,11R,13R,14R)-5-[tert-butyl(dimethyl)silyl]oxy-8-(2-oxoethyl)-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate.
| Compound Name | methyl (1S,4R,5R,8R,9S,11R,13R,14R)-5-[tert-butyl(dimethyl)silyl]oxy-8-(2-oxoethyl)-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate |
|---|---|
| PubChem CID | 10006696 |
| Molecular Formula | C28H38O7Si |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | methyl (1S,4R,5R,8R,9S,11R,13R,14R)-5-[tert-butyl(dimethyl)silyl]oxy-8-(2-oxoethyl)-11-phenyl-3,10,12-trioxatetracyclo[6.5.1.19,13.04,14]pentadec-6-ene-1-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@@H]3[C@@H]1[C@@](CC=O)(C=C[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H]2O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C28H38O7Si/c1-26(2,3)36(5,6)35-19-12-13-27(14-15-29)20-16-21(34-24(33-20)18-10-8-7-9-11-18)28(25(30)31-4)17-32-22(19)23(27)28/h7-13,15,19-24H,14,16-17H2,1-6H3/t19-,20+,21-,22+,23-,24-,27-,28+/m1/s1 |
| InChIKey | XCOKZMKDBWKPKV-BHAWUPHLSA-N |
| XLogP | 4.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|