C26H40O8Si — CID 135018906
ethyl 2-[(2R,3aR,7R,7aR)-6-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate (PubChem CID 135018906) has the molecular formula C26H40O8Si and a molecular weight of 508.68 g/mol. Its IUPAC name is ethyl 2-[(2R,3aR,7R,7aR)-6-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(2R,3aR,7R,7aR)-6-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 135018906 |
| Molecular Formula | C26H40O8Si |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | ethyl 2-[(2R,3aR,7R,7aR)-6-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1(OC(C)=O)OC[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40O8Si/c1-10-29-23(28)25(6,7)26(33-17(2)27)21(34-35(8,9)24(3,4)5)20-19(16-30-26)31-22(32-20)18-14-12-11-13-15-18/h11-15,19-22H,10,16H2,1-9H3/t19-,20-,21-,22-,26?/m1/s1 |
| InChIKey | JDPWZOBNWRGFRV-MYCALAORSA-N |
| XLogP | 4.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|