C28H46O6Si — CID 11318128
1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one (PubChem CID 11318128) has the molecular formula C28H46O6Si and a molecular weight of 506.76 g/mol. Its IUPAC name is 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one.
| Compound Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
|---|---|
| PubChem CID | 11318128 |
| Molecular Formula | C28H46O6Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 1-[(2R,4S,6R,8S,10S)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undecan-8-yl]butan-2-one |
| SMILES | CCC(=O)C[C@@H]1C[C@H](OC)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](COCc3ccccc3)O2)O1 |
| InChI | InChI=1S/C28H46O6Si/c1-8-22(29)14-23-15-24(30-5)17-28(32-23)18-25(34-35(6,7)27(2,3)4)16-26(33-28)20-31-19-21-12-10-9-11-13-21/h9-13,23-26H,8,14-20H2,1-7H3/t23-,24+,25+,26-,28-/m1/s1 |
| InChIKey | QSLLKEMCRYPPGM-BZTMQRDQSA-N |
| XLogP | 6.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|