C32H54O7Si — CID 10721932
2-[(4S,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 10721932) has the molecular formula C32H54O7Si and a molecular weight of 578.86 g/mol. Its IUPAC name is 2-[(4S,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4S,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 10721932 |
| Molecular Formula | C32H54O7Si |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 2-[(4S,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-[(4R,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]propyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CC1(C)O[C@H](CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H](CC=O)OC(C)(C)O2)C[C@H](CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C32H54O7Si/c1-30(2,3)40(8,9)39-28(29-22-26(17-19-33)36-32(6,7)38-29)16-15-25-21-27(37-31(4,5)35-25)18-20-34-23-24-13-11-10-12-14-24/h10-14,19,25-29H,15-18,20-23H2,1-9H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | AYSZRPYRDAYXBC-XYPQWYOHSA-N |
| XLogP | 7.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|