C25H42O4Si — CID 11080584
(2S)-2-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]propanal (PubChem CID 11080584) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is (2S)-2-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]propanal.
| Compound Name | (2S)-2-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]propanal |
|---|---|
| PubChem CID | 11080584 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (2S)-2-[(4S,5R,6S)-2,2-ditert-butyl-5-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-1,3,2-dioxasilinan-4-yl]propanal |
| SMILES | C[C@@H]1[C@H]([C@H](C)COCc2ccccc2)O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]1[C@H](C)C=O |
| InChI | InChI=1S/C25H42O4Si/c1-18(15-26)22-20(3)23(19(2)16-27-17-21-13-11-10-12-14-21)29-30(28-22,24(4,5)6)25(7,8)9/h10-15,18-20,22-23H,16-17H2,1-9H3/t18-,19-,20+,22-,23+/m1/s1 |
| InChIKey | VXNITDQYBJHELO-FQVVGKCUSA-N |
| XLogP | 6.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|