C32H54O6S2Si — CID 10952295
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentanal (PubChem CID 10952295) has the molecular formula C32H54O6S2Si and a molecular weight of 627.00 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentanal.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentanal |
|---|---|
| PubChem CID | 10952295 |
| Molecular Formula | C32H54O6S2Si |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-[[(2S,6R)-4,4-dimethoxy-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-dithian-2-yl]-4-methylpentanal |
| SMILES | COC1(OC)C[C@H](COCc2ccccc2)O[C@H](CC2(C(C)(C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C)SCCCS2)C1 |
| InChI | InChI=1S/C32H54O6S2Si/c1-29(2,3)41(8,9)38-28(16-17-33)30(4,5)32(39-18-13-19-40-32)22-26-20-31(34-6,35-7)21-27(37-26)24-36-23-25-14-11-10-12-15-25/h10-12,14-15,17,26-28H,13,16,18-24H2,1-9H3/t26-,27+,28-/m0/s1 |
| InChIKey | PGMZOAVYWJGRKL-IARZGTGTSA-N |
| XLogP | 7.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|