C30H50O4S2Si — CID 135017917
(8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-10-(2-methylbut-3-en-2-yl)-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol (PubChem CID 135017917) has the molecular formula C30H50O4S2Si and a molecular weight of 566.95 g/mol. Its IUPAC name is (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-10-(2-methylbut-3-en-2-yl)-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol.
| Compound Name | (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-10-(2-methylbut-3-en-2-yl)-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol |
|---|---|
| PubChem CID | 135017917 |
| Molecular Formula | C30H50O4S2Si |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (8R)-8-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxybutyl]-10-(2-methylbut-3-en-2-yl)-9-oxa-1,5-dithiaspiro[5.5]undecan-10-ol |
| SMILES | C=CC(C)(C)C1(O)CC2(C[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)OCc3ccccc3)O1)SCCCS2 |
| InChI | InChI=1S/C30H50O4S2Si/c1-10-28(6,7)30(31)22-29(35-17-14-18-36-29)20-25(33-30)19-26(34-37(8,9)27(3,4)5)23(2)32-21-24-15-12-11-13-16-24/h10-13,15-16,23,25-26,31H,1,14,17-22H2,2-9H3/t23-,25-,26-,30?/m1/s1 |
| InChIKey | RISNMLVKJWBAGN-MNERSFFUSA-N |
| XLogP | 8.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|