C32H52O7SSi — CID 131733236
S-ethyl (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioate (PubChem CID 131733236) has the molecular formula C32H52O7SSi and a molecular weight of 608.91 g/mol. Its IUPAC name is S-ethyl (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioate.
| Compound Name | S-ethyl (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioate |
|---|---|
| PubChem CID | 131733236 |
| Molecular Formula | C32H52O7SSi |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | S-ethyl (E)-4-[(2S,6S)-6-[(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethoxy)butyl]-2-methoxy-3-oxooxan-2-yl]-4-methylpent-2-enethioate |
| SMILES | CCSC(=O)/C=C/C(C)(C)[C@]1(OC)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)OCOCc2ccccc2)CCC1=O |
| InChI | InChI=1S/C32H52O7SSi/c1-11-40-29(34)19-20-31(6,7)32(35-8)28(33)18-17-26(38-32)21-27(39-41(9,10)30(3,4)5)24(2)37-23-36-22-25-15-13-12-14-16-25/h12-16,19-20,24,26-27H,11,17-18,21-23H2,1-10H3/b20-19+/t24-,26+,27-,32-/m1/s1 |
| InChIKey | RBJZOGDLUJGMEL-HTUMLKRJSA-N |
| XLogP | 7.30 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|