C32H52O7Si — CID 14081631
(E)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]prop-2-en-1-one (PubChem CID 14081631) has the molecular formula C32H52O7Si and a molecular weight of 576.85 g/mol. Its IUPAC name is (E)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 14081631 |
| Molecular Formula | C32H52O7Si |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | (E)-1-[(4R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-3-[(4S,6S)-2,2-dimethyl-6-(2-phenylmethoxyethyl)-1,3-dioxan-4-yl]prop-2-en-1-one |
| SMILES | CC1(C)O[C@@H](CCOCc2ccccc2)C[C@@H](/C=C/C(=O)[C@H]2C[C@@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C32H52O7Si/c1-30(2,3)40(8,9)35-20-18-27-22-29(39-32(6,7)38-27)28(33)16-15-25-21-26(37-31(4,5)36-25)17-19-34-23-24-13-11-10-12-14-24/h10-16,25-27,29H,17-23H2,1-9H3/b16-15+/t25-,26+,27-,29-/m1/s1 |
| InChIKey | KOHLCXAQENEBHB-NTHINXNXSA-N |
| XLogP | 6.95 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|